Olivia lee
Leave a message
| Name | 4-Fluorophenol |
| Synonyms | p-Fluorphenol |
| P-FLUOROPHENOL | |
| O-Fluorophenol | |
| p-fluorophenol | |
| 4-Fluorophenol | |
| 4-FLUOROPHENOL | |
| Phenol, p-fluoro- | |
| Phenol, 4-fluoro- | |
| AKOS BBS-00004253 | |
| Fluorophenoloffwhiteflakes | |
| CAS | 371-41-5 |
| EINECS | 206-736-0 |
| InChI | InChI=1/C6H5FO/c7-5-1-3-6(8)4-2-5/h1-4,8H |
| Physico-chemical Properties | |
| Molecular Formula | C6H5FO |
| Molar Mass | 112.1 |
| Density | 1.22 |
| Melting Point | 43-46 °C (lit.) |
| Boling Point | 185 °C (lit.) |
| Flash Point | 155°F |
| Water Solubility | 50 g/L |
| Solubility | 80g/l |
| Vapor Presure | 0.569mmHg at 25°C |
| Appearance | Crystalline Solid |
| Color | Yellow-beige to pink |
| BRN | 1362752 |
| pKa | 9.89(at 25℃) |
| PH | 5.4 (H2O, 20℃)(saturated aqueous solution) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Stability | Stable. Flammable. Incompatible with strong oxidizing agents. |
| Refractive Index | 1.523 |
| Physical and Chemical Properties | Crystallization. Melting Point 46-48 °c, boiling point 185 °c, flash point 68 °c. |
| Use | Used as pharmaceutical, pesticide and dye intermediates |
| Risk and Safety | |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| R36/37/38 - Irritating to eyes, respiratory system and skin. | |
| R52/53 - Harmful to aquatic organisms, may cause long-term adverse effects in the aquatic environment. | |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| S37/39 - Wear suitable gloves and eye/face protection | |
| S61 - Avoid release to the environment. Refer to special instructions / safety data sheets. | |
| S36 - Wear suitable protective clothing. | |
| UN IDs | UN 2928 6.1/PG 2 |
| WGK Germany | 1 |
| RTECS | SL4550000 |
| TSCA | T |
| HS Code | 29081000 |
| Hazard Note | Corrosive/Harmful |
| Hazard Class | 6.1 |
| Packing Group | III |
Copyright © 2006-2022 Gansu Junmao New Materials Technology Co., Ltd. All Rights Reserved. SITEMAP
